C17H13F7N4O3S — CID 153412147
3-ethoxysulfanyloxy-2-[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine (PubChem CID 153412147) has the molecular formula C17H13F7N4O3S and a molecular weight of 486.37 g/mol. Its IUPAC name is 3-ethoxysulfanyloxy-2-[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine.
| Compound Name | 3-ethoxysulfanyloxy-2-[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 153412147 |
| Molecular Formula | C17H13F7N4O3S |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 3-ethoxysulfanyloxy-2-[5-(2,2,3,3-tetrafluoropropoxy)pyrazin-2-yl]-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| SMILES | CCOSOc1c(-c2cnc(OCC(F)(F)C(F)F)cn2)nc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C17H13F7N4O3S/c1-2-30-32-31-14-13(27-11-4-3-9(7-28(11)14)17(22,23)24)10-5-26-12(6-25-10)29-8-16(20,21)15(18)19/h3-7,15H,2,8H2,1H3 |
| InChIKey | CHVIUQNZALESIK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|