C16H18N4O4S — CID 161271896
6-(5-ethoxy-3-ethoxysulfanyloxy-2-pyridinyl)-2-methylimidazo[1,2-c]pyrimidin-5-one (PubChem CID 161271896) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 6-(5-ethoxy-3-ethoxysulfanyloxy-2-pyridinyl)-2-methylimidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 6-(5-ethoxy-3-ethoxysulfanyloxy-2-pyridinyl)-2-methylimidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 161271896 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-(5-ethoxy-3-ethoxysulfanyloxy-2-pyridinyl)-2-methylimidazo[1,2-c]pyrimidin-5-one |
| SMILES | CCOSOc1cc(OCC)cnc1-n1ccc2nc(C)cn2c1=O |
| InChI | InChI=1S/C16H18N4O4S/c1-4-22-12-8-13(24-25-23-5-2)15(17-9-12)19-7-6-14-18-11(3)10-20(14)16(19)21/h6-10H,4-5H2,1-3H3 |
| InChIKey | VDXWKLCTALJRPU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|