C19H16BrN3O3S — CID 164960572
2-(6-bromo-3-ethoxysulfanyloxyimidazo[1,2-a]pyridin-2-yl)-6-methylisoquinolin-1-one (PubChem CID 164960572) has the molecular formula C19H16BrN3O3S and a molecular weight of 446.33 g/mol. Its IUPAC name is 2-(6-bromo-3-ethoxysulfanyloxyimidazo[1,2-a]pyridin-2-yl)-6-methylisoquinolin-1-one.
| Compound Name | 2-(6-bromo-3-ethoxysulfanyloxyimidazo[1,2-a]pyridin-2-yl)-6-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 164960572 |
| Molecular Formula | C19H16BrN3O3S |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | 2-(6-bromo-3-ethoxysulfanyloxyimidazo[1,2-a]pyridin-2-yl)-6-methylisoquinolin-1-one |
| SMILES | CCOSOc1c(-n2ccc3cc(C)ccc3c2=O)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C19H16BrN3O3S/c1-3-25-27-26-19-17(21-16-7-5-14(20)11-23(16)19)22-9-8-13-10-12(2)4-6-15(13)18(22)24/h4-11H,3H2,1-2H3 |
| InChIKey | BUAHDWUPUCCPEO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|