C22H27F2N5O2 — CID 177118238
5,5-difluoro-3-[2-[(2S)-2-methyl-1,4-diazepan-1-yl]pyrimidin-4-yl]spiro[4,6-dihydro-1,2-benzoxazole-7,2'-cyclohexane]-1'-one (PubChem CID 177118238) has the molecular formula C22H27F2N5O2 and a molecular weight of 431.49 g/mol. Its IUPAC name is 5,5-difluoro-3-[2-[(2S)-2-methyl-1,4-diazepan-1-yl]pyrimidin-4-yl]spiro[4,6-dihydro-1,2-benzoxazole-7,2'-cyclohexane]-1'-one.
| Compound Name | 5,5-difluoro-3-[2-[(2S)-2-methyl-1,4-diazepan-1-yl]pyrimidin-4-yl]spiro[4,6-dihydro-1,2-benzoxazole-7,2'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 177118238 |
| Molecular Formula | C22H27F2N5O2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 5,5-difluoro-3-[2-[(2S)-2-methyl-1,4-diazepan-1-yl]pyrimidin-4-yl]spiro[4,6-dihydro-1,2-benzoxazole-7,2'-cyclohexane]-1'-one |
| SMILES | C[C@H]1CNCCCN1c1nccc(-c2noc3c2CC(F)(F)CC32CCCCC2=O)n1 |
| InChI | InChI=1S/C22H27F2N5O2/c1-14-12-25-8-4-10-29(14)20-26-9-6-16(27-20)18-15-11-22(23,24)13-21(19(15)31-28-18)7-3-2-5-17(21)30/h6,9,14,25H,2-5,7-8,10-13H2,1H3/t14-,21?/m0/s1 |
| InChIKey | NQWIGDMDWNDTNN-YXWRBFHGSA-N |
| XLogP | 3.28 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |