C41H42FN7O7 — CID 177118710
benzyl N-[2-[2-[(2-aminobenzoyl)amino]ethoxy]ethyl]-N-[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 177118710) has the molecular formula C41H42FN7O7 and a molecular weight of 763.83 g/mol. Its IUPAC name is benzyl N-[2-[2-[(2-aminobenzoyl)amino]ethoxy]ethyl]-N-[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[(2-aminobenzoyl)amino]ethoxy]ethyl]-N-[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 177118710 |
| Molecular Formula | C41H42FN7O7 |
| Molecular Weight | 763.83 g/mol |
| Exact Mass | 763.31 |
| IUPAC Name | benzyl N-[2-[2-[(2-aminobenzoyl)amino]ethoxy]ethyl]-N-[2-[4-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | Nc1ccccc1C(=O)NCCOCCN(CC(=O)N1CCN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)CC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H42FN7O7/c42-34-15-14-29(25-36-30-10-4-5-11-31(30)39(52)46-45-36)24-33(34)40(53)48-19-17-47(18-20-48)37(50)26-49(41(54)56-27-28-8-2-1-3-9-28)21-23-55-22-16-44-38(51)32-12-6-7-13-35(32)43/h1-15,24H,16-23,25-27,43H2,(H,44,51)(H,46,52) |
| InChIKey | GJORWMJNGWHUPY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|