C52H43NSSi — CID 177121482
9,9-dimethyl-N-(4-naphtho[1,2-b][1]benzothiol-10-ylphenyl)-N-[4-(4-trimethylsilylphenyl)phenyl]fluoren-3-amine (PubChem CID 177121482) has the molecular formula C52H43NSSi and a molecular weight of 742.08 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-naphtho[1,2-b][1]benzothiol-10-ylphenyl)-N-[4-(4-trimethylsilylphenyl)phenyl]fluoren-3-amine.
| Compound Name | 9,9-dimethyl-N-(4-naphtho[1,2-b][1]benzothiol-10-ylphenyl)-N-[4-(4-trimethylsilylphenyl)phenyl]fluoren-3-amine |
|---|---|
| PubChem CID | 177121482 |
| Molecular Formula | C52H43NSSi |
| Molecular Weight | 742.08 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 9,9-dimethyl-N-(4-naphtho[1,2-b][1]benzothiol-10-ylphenyl)-N-[4-(4-trimethylsilylphenyl)phenyl]fluoren-3-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(N(c3ccc(-c4ccc([Si](C)(C)C)cc4)cc3)c3ccc(-c4cccc5c4sc4c6ccccc6ccc54)cc3)ccc21 |
| InChI | InChI=1S/C52H43NSSi/c1-52(2)48-16-9-8-13-44(48)47-33-40(28-32-49(47)52)53(38-24-17-34(18-25-38)35-21-29-41(30-22-35)55(3,4)5)39-26-19-37(20-27-39)43-14-10-15-45-46-31-23-36-11-6-7-12-42(36)51(46)54-50(43)45/h6-33H,1-5H3 |
| InChIKey | KJQJNXDKTVJJFP-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.08 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|