C27H47N5O12 — CID 177122455
(2R,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-(propanoylamino)propyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[6-[1-[2-(2-methoxyethoxy)ethyl]triazol-4-yl]hexoxy]oxane-2-carboxylic acid (PubChem CID 177122455) has the molecular formula C27H47N5O12 and a molecular weight of 633.70 g/mol. Its IUPAC name is (2R,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-(propanoylamino)propyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[6-[1-[2-(2-methoxyethoxy)ethyl]triazol-4-yl]hexoxy]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-(propanoylamino)propyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[6-[1-[2-(2-methoxyethoxy)ethyl]triazol-4-yl]hexoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 177122455 |
| Molecular Formula | C27H47N5O12 |
| Molecular Weight | 633.70 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | (2R,4S,5R,6R)-6-[(1R,2R)-1,2-dihydroxy-3-(propanoylamino)propyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-[6-[1-[2-(2-methoxyethoxy)ethyl]triazol-4-yl]hexoxy]oxane-2-carboxylic acid |
| SMILES | CCC(=O)NC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](OCCCCCCc2cn(CCOCCOC)nn2)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO |
| InChI | InChI=1S/C27H47N5O12/c1-3-21(36)28-15-20(35)24(38)25-23(29-22(37)17-33)19(34)14-27(44-25,26(39)40)43-10-7-5-4-6-8-18-16-32(31-30-18)9-11-42-13-12-41-2/h16,19-20,23-25,33-35,38H,3-15,17H2,1-2H3,(H,28,36)(H,29,37)(H,39,40)/t19-,20+,23+,24+,25+,27+/m0/s1 |
| InChIKey | IUCPHLLHRUJHGL-WDFYMANKSA-N |
| XLogP | -2.28 |
| TPSA | 244.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.70 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|