C11H23NO2 — CID 177126087
3,4-dimethyl-3-(2-propan-2-yloxyethyl)morpholine (PubChem CID 177126087) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 3,4-dimethyl-3-(2-propan-2-yloxyethyl)morpholine.
| Compound Name | 3,4-dimethyl-3-(2-propan-2-yloxyethyl)morpholine |
|---|---|
| PubChem CID | 177126087 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3,4-dimethyl-3-(2-propan-2-yloxyethyl)morpholine |
| SMILES | CC(C)OCCC1(C)COCCN1C |
| InChI | InChI=1S/C11H23NO2/c1-10(2)14-7-5-11(3)9-13-8-6-12(11)4/h10H,5-9H2,1-4H3 |
| InChIKey | VNZIIZKXKUZGLO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |