C15H34N2O2 — CID 163271444
ethane;N-(2-methylpropyl)acetamide;3,3,4-trimethylmorpholine (PubChem CID 163271444) has the molecular formula C15H34N2O2 and a molecular weight of 274.45 g/mol. Its IUPAC name is ethane;N-(2-methylpropyl)acetamide;3,3,4-trimethylmorpholine.
| Compound Name | ethane;N-(2-methylpropyl)acetamide;3,3,4-trimethylmorpholine |
|---|---|
| PubChem CID | 163271444 |
| Molecular Formula | C15H34N2O2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.26 |
| IUPAC Name | ethane;N-(2-methylpropyl)acetamide;3,3,4-trimethylmorpholine |
| SMILES | CC.CC(=O)NCC(C)C.CN1CCOCC1(C)C |
| InChI | InChI=1S/C7H15NO.C6H13NO.C2H6/c1-7(2)6-9-5-4-8(7)3;1-5(2)4-7-6(3)8;1-2/h4-6H2,1-3H3;5H,4H2,1-3H3,(H,7,8);1-2H3 |
| InChIKey | QSPISHCMHMKHFW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |