About (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride
(2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride (PubChem CID 119876449) has the molecular formula C11H25Cl2N3O2
and a molecular weight of 302.25 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride |
| PubChem CID | 119876449 |
| Molecular Formula | C11H25Cl2N3O2 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride |
| SMILES | C[C@@H](N)C(=O)NCCN1CCOCC1(C)C.Cl.Cl |
| InChI | InChI=1S/C11H23N3O2.2ClH/c1-9(12)10(15)13-4-5-14-6-7-16-8-11(14,2)3;;/h9H,4-8,12H2,1-3H3,(H,13,15);2*1H/t9-;;/m1../s1 |
| InChIKey | NUJMAFQIAAGEQH-KLQYNRQASA-N |
| XLogP | 0.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride?
The IUPAC name of (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride (CID 119876449) is (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride.
What is the SMILES notation for (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride?
The canonical SMILES for (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride is C[C@@H](N)C(=O)NCCN1CCOCC1(C)C.Cl.Cl.
What is the InChIKey of (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride?
The InChIKey is NUJMAFQIAAGEQH-KLQYNRQASA-N. The full InChI is InChI=1S/C11H23N3O2.2ClH/c1-9(12)10(15)13-4-5-14-6-7-16-8-11(14,2)3;;/h9H,4-8,12H2,1-3H3,(H,13,15);2*1H/t9-;;/m1../s1.
What are the key properties of (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride?
(2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride has a molecular weight of 302.25 g/mol, XLogP of 0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]propanamide;dihydrochloride is sourced from PubChem (CID 119876449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).