About 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride
1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride (PubChem CID 119876411) has the molecular formula C12H25Cl2N3O2
and a molecular weight of 314.26 g/mol. Its IUPAC name is 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride.
Molecular Properties
| Compound Name | 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride |
| PubChem CID | 119876411 |
| Molecular Formula | C12H25Cl2N3O2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride |
| SMILES | CC1(C)COCCN1CCNC(=O)C1(N)CC1.Cl.Cl |
| InChI | InChI=1S/C12H23N3O2.2ClH/c1-11(2)9-17-8-7-15(11)6-5-14-10(16)12(13)3-4-12;;/h3-9,13H2,1-2H3,(H,14,16);2*1H |
| InChIKey | ABFLILUQZUAOPS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride?
The IUPAC name of 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride (CID 119876411) is 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride.
What is the SMILES notation for 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride?
The canonical SMILES for 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride is CC1(C)COCCN1CCNC(=O)C1(N)CC1.Cl.Cl.
What is the InChIKey of 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride?
The InChIKey is ABFLILUQZUAOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O2.2ClH/c1-11(2)9-17-8-7-15(11)6-5-14-10(16)12(13)3-4-12;;/h3-9,13H2,1-2H3,(H,14,16);2*1H.
What are the key properties of 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride?
1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride has a molecular weight of 314.26 g/mol, XLogP of 0.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]cyclopropane-1-carboxamide;dihydrochloride is sourced from PubChem (CID 119876411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).