About 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride
3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride (PubChem CID 120503703) has the molecular formula C13H29Cl2N3O2
and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride.
Molecular Properties
| Compound Name | 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride |
| PubChem CID | 120503703 |
| Molecular Formula | C13H29Cl2N3O2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride |
| SMILES | CC(N)C(C)C(=O)NCCN1CCOCC1(C)C.Cl.Cl |
| InChI | InChI=1S/C13H27N3O2.2ClH/c1-10(11(2)14)12(17)15-5-6-16-7-8-18-9-13(16,3)4;;/h10-11H,5-9,14H2,1-4H3,(H,15,17);2*1H |
| InChIKey | QBEGOBDDIJMLHG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride?
The IUPAC name of 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride (CID 120503703) is 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride.
What is the SMILES notation for 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride?
The canonical SMILES for 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride is CC(N)C(C)C(=O)NCCN1CCOCC1(C)C.Cl.Cl.
What is the InChIKey of 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride?
The InChIKey is QBEGOBDDIJMLHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2.2ClH/c1-10(11(2)14)12(17)15-5-6-16-7-8-18-9-13(16,3)4;;/h10-11H,5-9,14H2,1-4H3,(H,15,17);2*1H.
What are the key properties of 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride?
3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride has a molecular weight of 330.30 g/mol, XLogP of 1.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]-2-methylbutanamide;dihydrochloride is sourced from PubChem (CID 120503703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).