C10H21N3O2 — CID 119876464
2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]acetamide (PubChem CID 119876464) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]acetamide.
| Compound Name | 2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 119876464 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-amino-N-[2-(3,3-dimethylmorpholin-4-yl)ethyl]acetamide |
| SMILES | CC1(C)COCCN1CCNC(=O)CN |
| InChI | InChI=1S/C10H21N3O2/c1-10(2)8-15-6-5-13(10)4-3-12-9(14)7-11/h3-8,11H2,1-2H3,(H,12,14) |
| InChIKey | RKZPBHJDYWSFMP-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |