methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate

C10H19NO3 — CID 61433080

IUPACmethyl 3-(3,3-dimethylmorpholin-4-yl)propanoate
SMILESCOC(=O)CCN1CCOCC1(C)C
InChIInChI=1S/C10H19NO3/c1-10(2)8-14-7-6-11(10)5-4-9(12)13-3/h4-8H2,1-3H3
InChIKeyUSMZUXDCKJBRFV-UHFFFAOYSA-N
MW201.27 g/mol
LogP0.66
Rot. Bonds3

About methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate

methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate (PubChem CID 61433080) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(3,3-dimethylmorpholin-4-yl)propanoate
PubChem CID61433080
Molecular FormulaC10H19NO3
Molecular Weight201.27 g/mol
Exact Mass201.14
IUPAC Namemethyl 3-(3,3-dimethylmorpholin-4-yl)propanoate
SMILESCOC(=O)CCN1CCOCC1(C)C
InChIInChI=1S/C10H19NO3/c1-10(2)8-14-7-6-11(10)5-4-9(12)13-3/h4-8H2,1-3H3
InChIKeyUSMZUXDCKJBRFV-UHFFFAOYSA-N
XLogP0.66
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.27
LogP ≤ 50.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate?
The IUPAC name of methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate (CID 61433080) is methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate.
What is the SMILES notation for methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate?
The canonical SMILES for methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate is COC(=O)CCN1CCOCC1(C)C.
What is the InChIKey of methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate?
The InChIKey is USMZUXDCKJBRFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-10(2)8-14-7-6-11(10)5-4-9(12)13-3/h4-8H2,1-3H3.
What are the key properties of methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate?
methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate has a molecular weight of 201.27 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate is sourced from PubChem (CID 61433080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).