C10H19NO3 — CID 61433080
methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate (PubChem CID 61433080) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate.
| Compound Name | methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate |
|---|---|
| PubChem CID | 61433080 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methyl 3-(3,3-dimethylmorpholin-4-yl)propanoate |
| SMILES | COC(=O)CCN1CCOCC1(C)C |
| InChI | InChI=1S/C10H19NO3/c1-10(2)8-14-7-6-11(10)5-4-9(12)13-3/h4-8H2,1-3H3 |
| InChIKey | USMZUXDCKJBRFV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |