C12H20FNO2 — CID 177126152
tert-butyl (3S,5R)-2-ethenyl-3-fluoro-5-methylpyrrolidine-1-carboxylate (PubChem CID 177126152) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is tert-butyl (3S,5R)-2-ethenyl-3-fluoro-5-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5R)-2-ethenyl-3-fluoro-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177126152 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | tert-butyl (3S,5R)-2-ethenyl-3-fluoro-5-methylpyrrolidine-1-carboxylate |
| SMILES | C=CC1[C@@H](F)C[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20FNO2/c1-6-10-9(13)7-8(2)14(10)11(15)16-12(3,4)5/h6,8-10H,1,7H2,2-5H3/t8-,9+,10?/m1/s1 |
| InChIKey | QGVGBAOEYQQYNF-ZDGBYWQASA-N |
| XLogP | 2.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|