C12H6BClO — CID 177129415
CID 177129415 (PubChem CID 177129415) has the molecular formula C12H6BClO and a molecular weight of 218.48 g/mol.
| Compound Name | CID 177129415 |
|---|---|
| PubChem CID | 177129415 |
| Molecular Formula | C12H6BClO |
| Molecular Weight | 218.48 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c(Cl)c2c(oc3c([2H])c([B])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C12H6BClO/c13-7-4-5-8-11(6-7)15-10-3-1-2-9(14)12(8)10/h1-6H/i1D,2D,3D,4D,5D,6D |
| InChIKey | SIFBWRXTJHBCQW-MZWXYZOWSA-N |
| XLogP | 3.03 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|