C12H7BO — CID 170927124
CID 170927124 (PubChem CID 170927124) has the molecular formula C12H7BO and a molecular weight of 184.04 g/mol.
| Compound Name | CID 170927124 |
|---|---|
| PubChem CID | 170927124 |
| Molecular Formula | C12H7BO |
| Molecular Weight | 184.04 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | — |
| SMILES | [2H]c1cc2c(oc3c([2H])c([2H])c([2H])c([B])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C12H7BO/c13-9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h1-7H/i1D,2D,3D,5D,6D,7D |
| InChIKey | HGVQVSHFWYKOCV-TXVUKIIJSA-N |
| XLogP | 2.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.04 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|