C12H8O — CID 90996406
1,2,3,4,6,7,8-heptadeuteriodibenzofuran (PubChem CID 90996406) has the molecular formula C12H8O and a molecular weight of 175.24 g/mol. Its IUPAC name is 1,2,3,4,6,7,8-heptadeuteriodibenzofuran.
| Compound Name | 1,2,3,4,6,7,8-heptadeuteriodibenzofuran |
|---|---|
| PubChem CID | 90996406 |
| Molecular Formula | C12H8O |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1,2,3,4,6,7,8-heptadeuteriodibenzofuran |
| SMILES | [2H]c1cc2c(oc3c([2H])c([2H])c([2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C12H8O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H/i1D,2D,3D,4D,5D,7D,8D |
| InChIKey | TXCDCPKCNAJMEE-ILEPUGBJSA-N |
| XLogP | 3.59 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |