C12H7BrO — CID 171588033
7-bromo-1,2,4,6,9-pentadeuteriodibenzofuran (PubChem CID 171588033) has the molecular formula C12H7BrO and a molecular weight of 252.12 g/mol. Its IUPAC name is 7-bromo-1,2,4,6,9-pentadeuteriodibenzofuran.
| Compound Name | 7-bromo-1,2,4,6,9-pentadeuteriodibenzofuran |
|---|---|
| PubChem CID | 171588033 |
| Molecular Formula | C12H7BrO |
| Molecular Weight | 252.12 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 7-bromo-1,2,4,6,9-pentadeuteriodibenzofuran |
| SMILES | [2H]c1cc([2H])c2oc3c([2H])c(Br)cc([2H])c3c2c1[2H] |
| InChI | InChI=1S/C12H7BrO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H/i1D,3D,4D,6D,7D |
| InChIKey | AZFABGHLDGJASW-KLXIPJGDSA-N |
| XLogP | 4.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |