C54H33N5S — CID 177130535
1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-isoquinolin-6-yl-6-[3-(8-phenyldibenzothiophen-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 177130535) has the molecular formula C54H33N5S and a molecular weight of 791.00 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-isoquinolin-6-yl-6-[3-(8-phenyldibenzothiophen-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-isoquinolin-6-yl-6-[3-(8-phenyldibenzothiophen-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 177130535 |
| Molecular Formula | C54H33N5S |
| Molecular Weight | 791.00 g/mol |
| Exact Mass | 790.29 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-[2-[4-isoquinolin-6-yl-6-[3-(8-phenyldibenzothiophen-4-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])c([2H])c([2H])c1n2-c1ccccc1-c1nc(-c2cccc(-c3cccc4c3sc3ccc(-c5ccccc5)cc34)c2)nc(-c2ccc3cnccc3c2)n1 |
| InChI | InChI=1S/C54H33N5S/c1-2-12-34(13-3-1)35-26-27-50-46(32-35)44-20-11-19-41(51(44)60-50)37-14-10-15-38(31-37)52-56-53(39-24-25-40-33-55-29-28-36(40)30-39)58-54(57-52)45-18-6-9-23-49(45)59-47-21-7-4-16-42(47)43-17-5-8-22-48(43)59/h1-33H/i4D,5D,7D,16D,17D,21D,22D |
| InChIKey | XLQDBHSPBWPRSU-MVUCQTIXSA-N |
| XLogP | 14.22 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.00 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |