C19H17ClF2N2 — CID 177134154
2-[(3-chloro-4-fluorophenyl)-(3-ethyl-4-fluorophenyl)methyl]-5-methyl-1H-imidazole (PubChem CID 177134154) has the molecular formula C19H17ClF2N2 and a molecular weight of 346.81 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)-(3-ethyl-4-fluorophenyl)methyl]-5-methyl-1H-imidazole.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)-(3-ethyl-4-fluorophenyl)methyl]-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 177134154 |
| Molecular Formula | C19H17ClF2N2 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)-(3-ethyl-4-fluorophenyl)methyl]-5-methyl-1H-imidazole |
| SMILES | CCc1cc(C(c2ccc(F)c(Cl)c2)c2ncc(C)[nH]2)ccc1F |
| InChI | InChI=1S/C19H17ClF2N2/c1-3-12-8-13(4-6-16(12)21)18(19-23-10-11(2)24-19)14-5-7-17(22)15(20)9-14/h4-10,18H,3H2,1-2H3,(H,23,24) |
| InChIKey | DKHQSFOHPINIJV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |