C17H39N3 — CID 177134730
ethane;N'-[(2S,5R)-5-methylheptan-2-yl]-N-[[(3S)-pyrrolidin-3-yl]methyl]ethane-1,2-diamine (PubChem CID 177134730) has the molecular formula C17H39N3 and a molecular weight of 285.52 g/mol. Its IUPAC name is ethane;N'-[(2S,5R)-5-methylheptan-2-yl]-N-[[(3S)-pyrrolidin-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | ethane;N'-[(2S,5R)-5-methylheptan-2-yl]-N-[[(3S)-pyrrolidin-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 177134730 |
| Molecular Formula | C17H39N3 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.31 |
| IUPAC Name | ethane;N'-[(2S,5R)-5-methylheptan-2-yl]-N-[[(3S)-pyrrolidin-3-yl]methyl]ethane-1,2-diamine |
| SMILES | CC.CC[C@@H](C)CC[C@H](C)NCCNC[C@H]1CCNC1 |
| InChI | InChI=1S/C15H33N3.C2H6/c1-4-13(2)5-6-14(3)18-10-9-17-12-15-7-8-16-11-15;1-2/h13-18H,4-12H2,1-3H3;1-2H3/t13-,14+,15+;/m1./s1 |
| InChIKey | FHZXIHPTMCEWOT-DSMRVHDJSA-N |
| XLogP | 3.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|