C21H26FN4OP — CID 177136140
5-(2-fluoropropan-2-yl)-3-methyl-2-[2-(1-methylphosphinan-4-yl)pyrazolo[3,4-b]pyrazin-6-yl]phenol (PubChem CID 177136140) has the molecular formula C21H26FN4OP and a molecular weight of 400.44 g/mol. Its IUPAC name is 5-(2-fluoropropan-2-yl)-3-methyl-2-[2-(1-methylphosphinan-4-yl)pyrazolo[3,4-b]pyrazin-6-yl]phenol.
| Compound Name | 5-(2-fluoropropan-2-yl)-3-methyl-2-[2-(1-methylphosphinan-4-yl)pyrazolo[3,4-b]pyrazin-6-yl]phenol |
|---|---|
| PubChem CID | 177136140 |
| Molecular Formula | C21H26FN4OP |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 5-(2-fluoropropan-2-yl)-3-methyl-2-[2-(1-methylphosphinan-4-yl)pyrazolo[3,4-b]pyrazin-6-yl]phenol |
| SMILES | Cc1cc(C(C)(C)F)cc(O)c1-c1cnc2cn(C3CCP(C)CC3)nc2n1 |
| InChI | InChI=1S/C21H26FN4OP/c1-13-9-14(21(2,3)22)10-18(27)19(13)16-11-23-17-12-26(25-20(17)24-16)15-5-7-28(4)8-6-15/h9-12,15,27H,5-8H2,1-4H3 |
| InChIKey | PMEPTMWSUUNIKI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|