C20H21F3N4O2 — CID 177136205
(5S)-5-[1-[2-amino-6-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-3-pyridinyl]ethylideneamino]piperidin-2-one (PubChem CID 177136205) has the molecular formula C20H21F3N4O2 and a molecular weight of 406.41 g/mol. Its IUPAC name is (5S)-5-[1-[2-amino-6-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-3-pyridinyl]ethylideneamino]piperidin-2-one.
| Compound Name | (5S)-5-[1-[2-amino-6-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-3-pyridinyl]ethylideneamino]piperidin-2-one |
|---|---|
| PubChem CID | 177136205 |
| Molecular Formula | C20H21F3N4O2 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (5S)-5-[1-[2-amino-6-[2-hydroxy-6-methyl-4-(trifluoromethyl)phenyl]-3-pyridinyl]ethylideneamino]piperidin-2-one |
| SMILES | C/C(=N\[C@H]1CCC(=O)NC1)c1ccc(-c2c(C)cc(C(F)(F)F)cc2O)nc1N |
| InChI | InChI=1S/C20H21F3N4O2/c1-10-7-12(20(21,22)23)8-16(28)18(10)15-5-4-14(19(24)27-15)11(2)26-13-3-6-17(29)25-9-13/h4-5,7-8,13,28H,3,6,9H2,1-2H3,(H2,24,27)(H,25,29)/b26-11+/t13-/m0/s1 |
| InChIKey | HHHQVZFREGKHIN-RCMPGLAHSA-N |
| XLogP | 3.45 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|