C21H25F4N3O2 — CID 177136568
2-[6-amino-5-[(3-fluorooxan-4-yl)iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol;ethane (PubChem CID 177136568) has the molecular formula C21H25F4N3O2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-[6-amino-5-[(3-fluorooxan-4-yl)iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol;ethane.
| Compound Name | 2-[6-amino-5-[(3-fluorooxan-4-yl)iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol;ethane |
|---|---|
| PubChem CID | 177136568 |
| Molecular Formula | C21H25F4N3O2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[6-amino-5-[(3-fluorooxan-4-yl)iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol;ethane |
| SMILES | CC.Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(/C=N/C2CCOCC2F)c(N)n1 |
| InChI | InChI=1S/C19H19F4N3O2.C2H6/c1-10-6-12(19(21,22)23)7-16(27)17(10)15-3-2-11(18(24)26-15)8-25-14-4-5-28-9-13(14)20;1-2/h2-3,6-8,13-14,27H,4-5,9H2,1H3,(H2,24,26);1-2H3/b25-8+; |
| InChIKey | WWMBBYPNIQHWNX-ZAFAKPCCSA-N |
| XLogP | 4.94 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|