C20H22F3N3O2 — CID 177136373
2-[6-amino-5-[[(3S,4R)-3-methyloxan-4-yl]iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol (PubChem CID 177136373) has the molecular formula C20H22F3N3O2 and a molecular weight of 393.41 g/mol. Its IUPAC name is 2-[6-amino-5-[[(3S,4R)-3-methyloxan-4-yl]iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol.
| Compound Name | 2-[6-amino-5-[[(3S,4R)-3-methyloxan-4-yl]iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 177136373 |
| Molecular Formula | C20H22F3N3O2 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[6-amino-5-[[(3S,4R)-3-methyloxan-4-yl]iminomethyl]-2-pyridinyl]-3-methyl-5-(trifluoromethyl)phenol |
| SMILES | Cc1cc(C(F)(F)F)cc(O)c1-c1ccc(/C=N/[C@@H]2CCOC[C@H]2C)c(N)n1 |
| InChI | InChI=1S/C20H22F3N3O2/c1-11-7-14(20(21,22)23)8-17(27)18(11)16-4-3-13(19(24)26-16)9-25-15-5-6-28-10-12(15)2/h3-4,7-9,12,15,27H,5-6,10H2,1-2H3,(H2,24,26)/b25-9+/t12-,15-/m1/s1 |
| InChIKey | QGZUGRLYIZUXTH-BCVZSWRQSA-N |
| XLogP | 4.21 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|