C10H19N3O — CID 63662880
2,2-dimethyl-N'-(6-oxopiperidin-3-yl)propanimidamide (PubChem CID 63662880) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(6-oxopiperidin-3-yl)propanimidamide.
| Compound Name | 2,2-dimethyl-N'-(6-oxopiperidin-3-yl)propanimidamide |
|---|---|
| PubChem CID | 63662880 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 2,2-dimethyl-N'-(6-oxopiperidin-3-yl)propanimidamide |
| SMILES | CC(C)(C)/C(N)=N/C1CCC(=O)NC1 |
| InChI | InChI=1S/C10H19N3O/c1-10(2,3)9(11)13-7-4-5-8(14)12-6-7/h7H,4-6H2,1-3H3,(H2,11,13)(H,12,14) |
| InChIKey | CQGFGDPRAHFWEF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|