C24H30F2N8O — CID 177137153
(Z)-2-[amino(cyclopropyl)amino]-1-[1-[4-(2,4-difluorophenyl)-6,7-dimethylpteridin-2-yl]pyrrolidin-3-yl]ethenamine;methanol (PubChem CID 177137153) has the molecular formula C24H30F2N8O and a molecular weight of 484.56 g/mol. Its IUPAC name is (Z)-2-[amino(cyclopropyl)amino]-1-[1-[4-(2,4-difluorophenyl)-6,7-dimethylpteridin-2-yl]pyrrolidin-3-yl]ethenamine;methanol.
| Compound Name | (Z)-2-[amino(cyclopropyl)amino]-1-[1-[4-(2,4-difluorophenyl)-6,7-dimethylpteridin-2-yl]pyrrolidin-3-yl]ethenamine;methanol |
|---|---|
| PubChem CID | 177137153 |
| Molecular Formula | C24H30F2N8O |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (Z)-2-[amino(cyclopropyl)amino]-1-[1-[4-(2,4-difluorophenyl)-6,7-dimethylpteridin-2-yl]pyrrolidin-3-yl]ethenamine;methanol |
| SMILES | CO.Cc1nc2nc(N3CCC(/C(N)=C/N(N)C4CC4)C3)nc(-c3ccc(F)cc3F)c2nc1C |
| InChI | InChI=1S/C23H26F2N8.CH4O/c1-12-13(2)29-22-21(28-12)20(17-6-3-15(24)9-18(17)25)30-23(31-22)32-8-7-14(10-32)19(26)11-33(27)16-4-5-16;1-2/h3,6,9,11,14,16H,4-5,7-8,10,26-27H2,1-2H3;2H,1H3/b19-11-; |
| InChIKey | RKJXDHCTACDQDE-XHFAFUTOSA-N |
| XLogP | 2.55 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|