About methyl 4-pentylnonanoate
methyl 4-pentylnonanoate (PubChem CID 177137762) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is methyl 4-pentylnonanoate.
Molecular Properties
| Compound Name | methyl 4-pentylnonanoate |
| PubChem CID | 177137762 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | methyl 4-pentylnonanoate |
| SMILES | CCCCCC(CCCCC)CCC(=O)OC |
| InChI | InChI=1S/C15H30O2/c1-4-6-8-10-14(11-9-7-5-2)12-13-15(16)17-3/h14H,4-13H2,1-3H3 |
| InChIKey | ITKGPTQYEYUNMB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-pentylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-pentylnonanoate?
The IUPAC name of methyl 4-pentylnonanoate (CID 177137762) is methyl 4-pentylnonanoate.
What is the SMILES notation for methyl 4-pentylnonanoate?
The canonical SMILES for methyl 4-pentylnonanoate is CCCCCC(CCCCC)CCC(=O)OC.
What is the InChIKey of methyl 4-pentylnonanoate?
The InChIKey is ITKGPTQYEYUNMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-4-6-8-10-14(11-9-7-5-2)12-13-15(16)17-3/h14H,4-13H2,1-3H3.
What are the key properties of methyl 4-pentylnonanoate?
methyl 4-pentylnonanoate has a molecular weight of 242.40 g/mol, XLogP of 4.72, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-pentylnonanoate is sourced from PubChem (CID 177137762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).