C14H12F3N3O4S — CID 177138950
2-[5-amino-2-methoxy-3-(trifluoromethylsulfonyl)phenyl]pyridine-4-carboxamide (PubChem CID 177138950) has the molecular formula C14H12F3N3O4S and a molecular weight of 375.33 g/mol. Its IUPAC name is 2-[5-amino-2-methoxy-3-(trifluoromethylsulfonyl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-[5-amino-2-methoxy-3-(trifluoromethylsulfonyl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 177138950 |
| Molecular Formula | C14H12F3N3O4S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[5-amino-2-methoxy-3-(trifluoromethylsulfonyl)phenyl]pyridine-4-carboxamide |
| SMILES | COc1c(-c2cc(C(N)=O)ccn2)cc(N)cc1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O4S/c1-24-12-9(10-4-7(13(19)21)2-3-20-10)5-8(18)6-11(12)25(22,23)14(15,16)17/h2-6H,18H2,1H3,(H2,19,21) |
| InChIKey | KOMAGQJXSVPZBS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|