About 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide
2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide (PubChem CID 177139287) has the molecular formula C13H8F5N3O
and a molecular weight of 317.22 g/mol. Its IUPAC name is 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| PubChem CID | 177139287 |
| Molecular Formula | C13H8F5N3O |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(-c2cc(F)c(F)c(C(F)(F)F)c2N)c1 |
| InChI | InChI=1S/C13H8F5N3O/c14-7-4-6(8-3-5(12(20)22)1-2-21-8)11(19)9(10(7)15)13(16,17)18/h1-4H,19H2,(H2,20,22) |
| InChIKey | PLPCIUAOIMXSNO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide?
The IUPAC name of 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide (CID 177139287) is 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide.
What is the SMILES notation for 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide?
The canonical SMILES for 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide is NC(=O)c1ccnc(-c2cc(F)c(F)c(C(F)(F)F)c2N)c1.
What is the InChIKey of 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide?
The InChIKey is PLPCIUAOIMXSNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F5N3O/c14-7-4-6(8-3-5(12(20)22)1-2-21-8)11(19)9(10(7)15)13(16,17)18/h1-4H,19H2,(H2,20,22).
What are the key properties of 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide?
2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide has a molecular weight of 317.22 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-amino-4,5-difluoro-3-(trifluoromethyl)phenyl]pyridine-4-carboxamide is sourced from PubChem (CID 177139287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).