C32H39F5N3O4PS — CID 177139352
N-[2-[3-[difluoro(phosphanyl)methyl]but-3-enylcarbamoyl]-5-(trifluoromethyl)phenyl]-6-methoxy-2-methyl-1,3-benzothiazole-7-carboxamide;(Z)-2,4-dimethylhept-1-en-1-ol (PubChem CID 177139352) has the molecular formula C32H39F5N3O4PS and a molecular weight of 687.71 g/mol. Its IUPAC name is N-[2-[3-[difluoro(phosphanyl)methyl]but-3-enylcarbamoyl]-5-(trifluoromethyl)phenyl]-6-methoxy-2-methyl-1,3-benzothiazole-7-carboxamide;(Z)-2,4-dimethylhept-1-en-1-ol.
| Compound Name | N-[2-[3-[difluoro(phosphanyl)methyl]but-3-enylcarbamoyl]-5-(trifluoromethyl)phenyl]-6-methoxy-2-methyl-1,3-benzothiazole-7-carboxamide;(Z)-2,4-dimethylhept-1-en-1-ol |
|---|---|
| PubChem CID | 177139352 |
| Molecular Formula | C32H39F5N3O4PS |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | N-[2-[3-[difluoro(phosphanyl)methyl]but-3-enylcarbamoyl]-5-(trifluoromethyl)phenyl]-6-methoxy-2-methyl-1,3-benzothiazole-7-carboxamide;(Z)-2,4-dimethylhept-1-en-1-ol |
| SMILES | C=C(CCNC(=O)c1ccc(C(F)(F)F)cc1NC(=O)c1c(OC)ccc2nc(C)sc12)C(F)(F)P.CCCC(C)C/C(C)=C\O |
| InChI | InChI=1S/C23H21F5N3O3PS.C9H18O/c1-11(23(27,28)35)8-9-29-20(32)14-5-4-13(22(24,25)26)10-16(14)31-21(33)18-17(34-3)7-6-15-19(18)36-12(2)30-15;1-4-5-8(2)6-9(3)7-10/h4-7,10H,1,8-9,35H2,2-3H3,(H,29,32)(H,31,33);7-8,10H,4-6H2,1-3H3/b;9-7- |
| InChIKey | FOSHYYNTLJYCEZ-QFWHIOIXSA-N |
| XLogP | 9.30 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|