C16H19F3N2O4 — CID 21396636
1-[[2-acetamido-4-(trifluoromethyl)benzoyl]amino]butan-2-yl acetate (PubChem CID 21396636) has the molecular formula C16H19F3N2O4 and a molecular weight of 360.33 g/mol. Its IUPAC name is 1-[[2-acetamido-4-(trifluoromethyl)benzoyl]amino]butan-2-yl acetate.
| Compound Name | 1-[[2-acetamido-4-(trifluoromethyl)benzoyl]amino]butan-2-yl acetate |
|---|---|
| PubChem CID | 21396636 |
| Molecular Formula | C16H19F3N2O4 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[[2-acetamido-4-(trifluoromethyl)benzoyl]amino]butan-2-yl acetate |
| SMILES | CCC(CNC(=O)c1ccc(C(F)(F)F)cc1NC(C)=O)OC(C)=O |
| InChI | InChI=1S/C16H19F3N2O4/c1-4-12(25-10(3)23)8-20-15(24)13-6-5-11(16(17,18)19)7-14(13)21-9(2)22/h5-7,12H,4,8H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | JNUBTXGVVJMWKX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |