C10H19N — CID 177141696
4,4,6-trimethylhept-1-en-3-imine (PubChem CID 177141696) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 4,4,6-trimethylhept-1-en-3-imine.
| Compound Name | 4,4,6-trimethylhept-1-en-3-imine |
|---|---|
| PubChem CID | 177141696 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 4,4,6-trimethylhept-1-en-3-imine |
| SMILES | [H]/N=C(\C=C)C(C)(C)CC(C)C |
| InChI | InChI=1S/C10H19N/c1-6-9(11)10(4,5)7-8(2)3/h6,8,11H,1,7H2,2-5H3/b11-9+ |
| InChIKey | MYBDVOPFLPODPJ-PKNBQFBNSA-N |
| XLogP | 3.26 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|