C11H21N — CID 138580985
2,3,3-trimethyloct-7-en-4-imine (PubChem CID 138580985) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2,3,3-trimethyloct-7-en-4-imine.
| Compound Name | 2,3,3-trimethyloct-7-en-4-imine |
|---|---|
| PubChem CID | 138580985 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2,3,3-trimethyloct-7-en-4-imine |
| SMILES | [H]/N=C(\CCC=C)C(C)(C)C(C)C |
| InChI | InChI=1S/C11H21N/c1-6-7-8-10(12)11(4,5)9(2)3/h6,9,12H,1,7-8H2,2-5H3/b12-10+ |
| InChIKey | MQCQAGSGLSHFSA-ZRDIBKRKSA-N |
| XLogP | 3.65 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|