C12H24IN — CID 130224247
7-iodo-2,3,3,7-tetramethyloctan-4-imine (PubChem CID 130224247) has the molecular formula C12H24IN and a molecular weight of 309.24 g/mol. Its IUPAC name is 7-iodo-2,3,3,7-tetramethyloctan-4-imine.
| Compound Name | 7-iodo-2,3,3,7-tetramethyloctan-4-imine |
|---|---|
| PubChem CID | 130224247 |
| Molecular Formula | C12H24IN |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 7-iodo-2,3,3,7-tetramethyloctan-4-imine |
| SMILES | [H]/N=C(\CCC(C)(C)I)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H24IN/c1-9(2)12(5,6)10(14)7-8-11(3,4)13/h9,14H,7-8H2,1-6H3/b14-10+ |
| InChIKey | GKJXVSNUQGOICH-GXDHUFHOSA-N |
| XLogP | 4.68 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|