C11H25N3 — CID 154999303
6-imino-3,3,7-trimethyloctane-1,5-diamine (PubChem CID 154999303) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 6-imino-3,3,7-trimethyloctane-1,5-diamine.
| Compound Name | 6-imino-3,3,7-trimethyloctane-1,5-diamine |
|---|---|
| PubChem CID | 154999303 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 6-imino-3,3,7-trimethyloctane-1,5-diamine |
| SMILES | [H]/N=C(\C(C)C)C(N)CC(C)(C)CCN |
| InChI | InChI=1S/C11H25N3/c1-8(2)10(14)9(13)7-11(3,4)5-6-12/h8-9,14H,5-7,12-13H2,1-4H3/b14-10+ |
| InChIKey | YSKVKTACVVAOTI-GXDHUFHOSA-N |
| XLogP | 1.75 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|