C11H22N2O3 — CID 65291208
(2R)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoic acid (PubChem CID 65291208) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2R)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 65291208 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | (2R)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)CCC(C)(C)CCN)C(=O)O |
| InChI | InChI=1S/C11H22N2O3/c1-8(10(15)16)13-9(14)4-5-11(2,3)6-7-12/h8H,4-7,12H2,1-3H3,(H,13,14)(H,15,16)/t8-/m1/s1 |
| InChIKey | QKUVESBBJIGCMN-MRVPVSSYSA-N |
| XLogP | 0.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |