C12H24N2O3 — CID 65290947
methyl (2S)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoate (PubChem CID 65290947) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl (2S)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoate |
|---|---|
| PubChem CID | 65290947 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | methyl (2S)-2-[(6-amino-4,4-dimethylhexanoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C12H24N2O3/c1-9(11(16)17-4)14-10(15)5-6-12(2,3)7-8-13/h9H,5-8,13H2,1-4H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | SUETXHSFFFHAEO-VIFPVBQESA-N |
| XLogP | 0.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |