About 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide
6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide (PubChem CID 65290645) has the molecular formula C15H31N3O2
and a molecular weight of 285.43 g/mol. Its IUPAC name is 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide.
Molecular Properties
| Compound Name | 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide |
| PubChem CID | 65290645 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide |
| SMILES | CCN(CC)C(=O)C(C)NC(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C15H31N3O2/c1-6-18(7-2)14(20)12(3)17-13(19)8-9-15(4,5)10-11-16/h12H,6-11,16H2,1-5H3,(H,17,19) |
| InChIKey | UKKHZRNYBZEBHX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide?
The IUPAC name of 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide (CID 65290645) is 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide.
What is the SMILES notation for 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide?
The canonical SMILES for 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide is CCN(CC)C(=O)C(C)NC(=O)CCC(C)(C)CCN.
What is the InChIKey of 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide?
The InChIKey is UKKHZRNYBZEBHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O2/c1-6-18(7-2)14(20)12(3)17-13(19)8-9-15(4,5)10-11-16/h12H,6-11,16H2,1-5H3,(H,17,19).
What are the key properties of 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide?
6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide has a molecular weight of 285.43 g/mol, XLogP of 1.51, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-N-[1-(diethylamino)-1-oxopropan-2-yl]-4,4-dimethylhexanamide is sourced from PubChem (CID 65290645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).