C17H28N2O2 — CID 81368822
6-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4,4-dimethylhexanamide (PubChem CID 81368822) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 81368822 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 6-amino-N-[(1S)-1-(4-methoxyphenyl)ethyl]-4,4-dimethylhexanamide |
| SMILES | COc1ccc([C@H](C)NC(=O)CCC(C)(C)CCN)cc1 |
| InChI | InChI=1S/C17H28N2O2/c1-13(14-5-7-15(21-4)8-6-14)19-16(20)9-10-17(2,3)11-12-18/h5-8,13H,9-12,18H2,1-4H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | JOMCQGVUMATNGV-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |