C15H23NO2 — CID 116574854
6-amino-1-(4-methoxyphenyl)-4,4-dimethylhexan-1-one (PubChem CID 116574854) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 6-amino-1-(4-methoxyphenyl)-4,4-dimethylhexan-1-one.
| Compound Name | 6-amino-1-(4-methoxyphenyl)-4,4-dimethylhexan-1-one |
|---|---|
| PubChem CID | 116574854 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 6-amino-1-(4-methoxyphenyl)-4,4-dimethylhexan-1-one |
| SMILES | COc1ccc(C(=O)CCC(C)(C)CCN)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-15(2,10-11-16)9-8-14(17)12-4-6-13(18-3)7-5-12/h4-7H,8-11,16H2,1-3H3 |
| InChIKey | GVXBNAIPAZSMND-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |