C8H17NO — CID 158629570
4-imino-3,5-dimethylhexan-2-ol (PubChem CID 158629570) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-imino-3,5-dimethylhexan-2-ol.
| Compound Name | 4-imino-3,5-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 158629570 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 4-imino-3,5-dimethylhexan-2-ol |
| SMILES | [H]/N=C(\C(C)C)C(C)C(C)O |
| InChI | InChI=1S/C8H17NO/c1-5(2)8(9)6(3)7(4)10/h5-7,9-10H,1-4H3/b9-8+ |
| InChIKey | GCJABLVCNNLZFH-CMDGGOBGSA-N |
| XLogP | 1.68 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|