C9H19NO4 — CID 134382365
6-imino-7-methyloctane-2,3,4,5-tetrol (PubChem CID 134382365) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 6-imino-7-methyloctane-2,3,4,5-tetrol.
| Compound Name | 6-imino-7-methyloctane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 134382365 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 6-imino-7-methyloctane-2,3,4,5-tetrol |
| SMILES | [H]/N=C(\C(C)C)C(O)C(O)C(O)C(C)O |
| InChI | InChI=1S/C9H19NO4/c1-4(2)6(10)8(13)9(14)7(12)5(3)11/h4-5,7-14H,1-3H3/b10-6+ |
| InChIKey | SDTVQYGZVWCMJI-UXBLZVDNSA-N |
| XLogP | -0.87 |
| TPSA | 104.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|