C8H19N3O2 — CID 88890970
(4R)-1,2-diamino-5-imino-6-methylheptane-3,4-diol (PubChem CID 88890970) has the molecular formula C8H19N3O2 and a molecular weight of 189.26 g/mol. Its IUPAC name is (4R)-1,2-diamino-5-imino-6-methylheptane-3,4-diol.
| Compound Name | (4R)-1,2-diamino-5-imino-6-methylheptane-3,4-diol |
|---|---|
| PubChem CID | 88890970 |
| Molecular Formula | C8H19N3O2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4R)-1,2-diamino-5-imino-6-methylheptane-3,4-diol |
| SMILES | [H]/N=C(\C(C)C)[C@@H](O)C(O)C(N)CN |
| InChI | InChI=1S/C8H19N3O2/c1-4(2)6(11)8(13)7(12)5(10)3-9/h4-5,7-8,11-13H,3,9-10H2,1-2H3/b11-6+/t5?,7?,8-/m1/s1 |
| InChIKey | IJJLRMZRYBCESH-CYZIIYCRSA-N |
| XLogP | -1.33 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|