C5H12N2O2 — CID 89425663
(3S)-2-amino-4-iminopentane-1,3-diol (PubChem CID 89425663) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is (3S)-2-amino-4-iminopentane-1,3-diol.
| Compound Name | (3S)-2-amino-4-iminopentane-1,3-diol |
|---|---|
| PubChem CID | 89425663 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (3S)-2-amino-4-iminopentane-1,3-diol |
| SMILES | [H]/N=C(\C)[C@@H](O)C(N)CO |
| InChI | InChI=1S/C5H12N2O2/c1-3(6)5(9)4(7)2-8/h4-6,8-9H,2,7H2,1H3/b6-3+/t4?,5-/m1/s1 |
| InChIKey | MZLKGRAIIWQJPE-MRCLHIKOSA-N |
| XLogP | -1.29 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|