C6H13NO4 — CID 150230549
5-amino-2,4,6-trihydroxyhexan-3-one (PubChem CID 150230549) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is 5-amino-2,4,6-trihydroxyhexan-3-one.
| Compound Name | 5-amino-2,4,6-trihydroxyhexan-3-one |
|---|---|
| PubChem CID | 150230549 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 5-amino-2,4,6-trihydroxyhexan-3-one |
| SMILES | CC(O)C(=O)C(O)C(N)CO |
| InChI | InChI=1S/C6H13NO4/c1-3(9)5(10)6(11)4(7)2-8/h3-4,6,8-9,11H,2,7H2,1H3 |
| InChIKey | FVJOZQNBIZHALH-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |