About N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol
N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol (PubChem CID 177142038) has the molecular formula C14H33NOS
and a molecular weight of 263.49 g/mol. Its IUPAC name is N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol.
Molecular Properties
| Compound Name | N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol |
| PubChem CID | 177142038 |
| Molecular Formula | C14H33NOS |
| Molecular Weight | 263.49 g/mol |
| Exact Mass | 263.23 |
| IUPAC Name | N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol |
| SMILES | CCCCCN(CC)CCC.CSCCCO |
| InChI | InChI=1S/C10H23N.C4H10OS/c1-4-7-8-10-11(6-3)9-5-2;1-6-4-2-3-5/h4-10H2,1-3H3;5H,2-4H2,1H3 |
| InChIKey | HVLVEBKLJKAESJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol?
The IUPAC name of N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol (CID 177142038) is N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol.
What is the SMILES notation for N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol?
The canonical SMILES for N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol is CCCCCN(CC)CCC.CSCCCO.
What is the InChIKey of N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol?
The InChIKey is HVLVEBKLJKAESJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C4H10OS/c1-4-7-8-10-11(6-3)9-5-2;1-6-4-2-3-5/h4-10H2,1-3H3;5H,2-4H2,1H3.
What are the key properties of N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol?
N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol has a molecular weight of 263.49 g/mol, XLogP of 3.64, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propylpentan-1-amine;3-methylsulfanylpropan-1-ol is sourced from PubChem (CID 177142038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).