C24H25N5O3 — CID 177143483
5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-isoquinolin-5-yl-4H-1,2,4-triazol-3-one (PubChem CID 177143483) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-isoquinolin-5-yl-4H-1,2,4-triazol-3-one.
| Compound Name | 5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-isoquinolin-5-yl-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 177143483 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 5-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]-2-isoquinolin-5-yl-4H-1,2,4-triazol-3-one |
| SMILES | COc1ccc(CN2CCCC(c3nn(-c4cccc5cnccc45)c(=O)[nH]3)C2)c(O)c1 |
| InChI | InChI=1S/C24H25N5O3/c1-32-19-8-7-17(22(30)12-19)14-28-11-3-5-18(15-28)23-26-24(31)29(27-23)21-6-2-4-16-13-25-10-9-20(16)21/h2,4,6-10,12-13,18,30H,3,5,11,14-15H2,1H3,(H,26,27,31) |
| InChIKey | KZICDVBQJRYGSX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|