C29H30N4O2 — CID 45209028
5-methoxy-2-[[3-[5-(2-methylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol (PubChem CID 45209028) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 5-methoxy-2-[[3-[5-(2-methylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol.
| Compound Name | 5-methoxy-2-[[3-[5-(2-methylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 45209028 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 5-methoxy-2-[[3-[5-(2-methylphenyl)-2-pyridin-4-ylpyrimidin-4-yl]piperidin-1-yl]methyl]phenol |
| SMILES | COc1ccc(CN2CCCC(c3nc(-c4ccncc4)ncc3-c3ccccc3C)C2)c(O)c1 |
| InChI | InChI=1S/C29H30N4O2/c1-20-6-3-4-8-25(20)26-17-31-29(21-11-13-30-14-12-21)32-28(26)23-7-5-15-33(19-23)18-22-9-10-24(35-2)16-27(22)34/h3-4,6,8-14,16-17,23,34H,5,7,15,18-19H2,1-2H3 |
| InChIKey | QETRRYGLZNEEHC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 71.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|